CAS 21086-33-9

2-bromo-1-(4-methoxyphenyl)propan-1-one

Description:

2-bromo-1-(4-methoxyphenyl)propan-1-one, with the CAS number 21086-33-9, is an organic compound characterized by its structure, which includes a bromine atom and a methoxy-substituted phenyl group attached to a propanone backbone. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is known for its reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The methoxy group enhances the compound's solubility in organic solvents and can influence its electronic properties, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. Additionally, the presence of both the bromine and methoxy groups can affect the compound's biological activity, potentially making it a candidate for further pharmacological studies. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed in laboratory settings.

Formula: C₁₀H₁₁BrO₂

InChI: InChI=1/C10H11BrO2/c1-7(11)10(12)8-3-5-9(13-2)6-4-8/h3-7H,1-2H3

SMILES: CC(C(=O)c1ccc(cc1)OC)Br

Synonyms:

• 1-Propanone, 2-Bromo-1-(4-Methoxyphenyl)-
• 4-Methoxy-Beta-Bromopropiophenone

2-Bromo-1-(4-methoxyphenyl)-1-propanone

CAS: 21086-33-9

Formula: C₁₀H₁₁BrO₂

Color and Shape: Solid

Molecular weight: 243.0971

Ref: IN-DA002L0Y

2-Bromo-1-(4-methoxyphenyl)propan-1-one

CAS: 21086-33-9

2-Bromo-1-(4-methoxyphenyl)propan-1-one

Purity: 95%

Color and Shape: Solid

Molecular weight: 243.10g/mol

Ref: 54-OR346565

2-Bromo-1-(4-methoxyphenyl)propan-1-one

CAS: 21086-33-9

2-Bromo-1-(4-methoxyphenyl)propan-1-one is a synthetic molecule that has been used to induce apoptosis in tumor cells. It reacts with ethanolamine to form 2,2'-dibromoethyl ether, which then reacts with nitrobenzene to produce the carcinogenic compound 4-nitrophenol. This compound induces apoptosis by inhibiting DNA synthesis and protein synthesis. The reaction time for this process is about 1 hour at room temperature. The structure of 2-bromo-1-(4-methoxyphenyl)propan-1-one is shown below:

Formula: C₁₀H₁₁BrO₂

Purity: Min. 95%

Molecular weight: 243.1 g/mol

Ref: 3D-WAA08633