
CAS 21088-15-3
:(1R)-1-(3,4-diethoxybenzyl)-6,7-diethoxy-1,2,3,4-tetrahydroisoquinolinium
Description:
(1R)-1-(3,4-Diethoxybenzyl)-6,7-diethoxy-1,2,3,4-tetrahydroisoquinolinium is a chemical compound characterized by its complex structure, which includes a tetrahydroisoquinoline core substituted with diethoxybenzyl and diethoxy groups. This compound typically exhibits properties associated with quaternary ammonium compounds, including potential solubility in polar solvents and the ability to form salts. Its stereochemistry, indicated by the (1R) designation, suggests specific spatial arrangements that can influence its biological activity and interactions. The presence of multiple ethoxy groups may enhance lipophilicity, affecting its pharmacokinetic properties. Additionally, compounds of this nature may exhibit interesting pharmacological activities, potentially acting on neurotransmitter systems or serving as precursors in synthetic pathways for various bioactive molecules. As with many organic compounds, stability, reactivity, and potential applications can vary significantly based on environmental conditions and the presence of other chemical species. Further studies would be necessary to fully elucidate its properties and potential uses in medicinal chemistry or other fields.
Formula:C24H34NO4
InChI:InChI=1/C24H33NO4/c1-5-26-21-10-9-17(14-22(21)27-6-2)13-20-19-16-24(29-8-4)23(28-7-3)15-18(19)11-12-25-20/h9-10,14-16,20,25H,5-8,11-13H2,1-4H3/p+1/t20-/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
1-(3,4-Diethoxybenzyl)-6,7-diethoxy-1,2,3,4-tetrahydroisoquinoline hydrochloride
CAS:Formula:C24H33NO4Molecular weight:399.5231


