CAS 2109805-75-4

2′,3′,5′,6′-Tetrahydro-6,7-bis[(4-nitrophenyl)methoxy]spiro[2H-1-benzopyran-2,4′-[4H]pyran]

Description:

2′,3′,5′,6′-Tetrahydro-6,7-bis[(4-nitrophenyl)methoxy]spiro[2H-1-benzopyran-2,4′-[4H]pyran] is a complex organic compound characterized by its spirocyclic structure, which incorporates both benzopyran and pyran moieties. This compound features multiple functional groups, including nitrophenyl and methoxy substituents, which contribute to its chemical reactivity and potential biological activity. The presence of nitro groups typically enhances the compound's electron-withdrawing properties, potentially influencing its interactions with biological targets. The spiro arrangement introduces unique stereochemical properties, which can affect the compound's conformation and, consequently, its reactivity and solubility. Such compounds may exhibit interesting pharmacological properties, making them subjects of interest in medicinal chemistry. Additionally, the molecular structure suggests potential applications in materials science or as intermediates in organic synthesis. However, specific properties such as solubility, melting point, and spectral characteristics would require empirical determination or literature reference for precise values.

Formula: C₂₇H₂₄N₂O₈

InChI: InChI=1S/C27H24N2O8/c30-28(31)22-5-1-19(2-6-22)17-35-25-15-21-9-10-27(11-13-34-14-12-27)37-24(21)16-26(25)36-18-20-3-7-23(8-4-20)29(32)33/h1-10,15-16H,11-14,17-18H2

InChI key: InChIKey=LHTNFHWDTHQECR-UHFFFAOYSA-N

SMILES: O(CC1=CC=C(N(=O)=O)C=C1)C=2C=C3OC4(C=CC3=CC2OCC5=CC=C(N(=O)=O)C=C5)CCOCC4

Synonyms:

• Spiro[2H-1-benzopyran-2,4′-[4H]pyran], 2′,3′,5′,6′-tetrahydro-6,7-bis[(4-nitrophenyl)methoxy]-
• 2′,3′,5′,6′-Tetrahydro-6,7-bis[(4-nitrophenyl)methoxy]spiro[2H-1-benzopyran-2,4′-[4H]pyran]

CU-CPT17e

CAS: 2109805-75-4

CU-CPT17e is a potent agonist of TLR(TLR3, TLR8, and TLR9).

Formula: C₂₇H₂₄N₂O₈

Purity: 98.49%

Color and Shape: Solid

Molecular weight: 504.49

Ref: TM-T10899

CU-CPT17e

CAS: 2109805-75-4

CU-CPT17e

Purity: ≥98%

Molecular weight: 504.49g/mol

Ref: 54-BUP00492

CU-CPT17e

CAS: 2109805-75-4

CU-CPT17e is a monoclonal antibody that binds to the C-terminal region of human cytomegalovirus (HCMV) glycoprotein B. This antibody has been shown to activate CMV-specific T cells in vitro and in vivo, leading to an increase in the production of cytokines such as IFN-γ and IL-2. CU-CPT17e also induces apoptosis in HCMV infected monocytic THP1 cells. It has been hypothesized that this activation of apoptosis is due to CU-CPT17e binding to the molecule on the cell surface that activates proinflammatory responses.

Formula: C₂₇H₂₄N₂O₈

Purity: Min. 95%

Molecular weight: 504.49 g/mol

Ref: 3D-JJD80575