CymitQuimica logo

CAS 21099-87-6

:

methyl N-[(7,8,10-trimethyl-2,4-dioxo-4,10-dihydrobenzo[g]pteridin-3(2H)-yl)acetyl]-L-tryptophanate

Description:
Methyl N-[(7,8,10-trimethyl-2,4-dioxo-4,10-dihydrobenzo[g]pteridin-3(2H)-yl)acetyl]-L-tryptophanate, identified by its CAS number 21099-87-6, is a complex organic compound characterized by its unique structural features. It contains a pteridine core, which is a bicyclic structure known for its role in various biological processes, particularly in the context of folate metabolism and as a cofactor in enzymatic reactions. The presence of multiple methyl groups contributes to its hydrophobic characteristics, potentially influencing its solubility and interaction with biological membranes. The acetyl and tryptophanate moieties suggest that this compound may exhibit biological activity, possibly interacting with amino acid pathways or serving as a precursor in biochemical synthesis. Its dioxo functional groups indicate potential reactivity, which could be relevant in medicinal chemistry or drug design. Overall, this compound's intricate structure and functional groups position it as a subject of interest in both synthetic and medicinal chemistry research.
Formula:C27H26N6O5
InChI:InChI=1/C27H26N6O5/c1-14-9-19-21(10-15(14)2)32(3)24-23(30-19)25(35)33(27(37)31-24)13-22(34)29-20(26(36)38-4)11-16-12-28-18-8-6-5-7-17(16)18/h5-10,12,20,28H,11,13H2,1-4H3,(H,29,34)/t20-/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.