CAS 2110-18-1: 2-(3-Phenylpropyl)pyridine
Description:2-(3-Phenylpropyl)pyridine, with the CAS number 2110-18-1, is an organic compound characterized by its pyridine ring substituted with a 3-phenylpropyl group. This compound typically exhibits a pale yellow to brownish liquid appearance. It has a molecular formula that reflects its structure, containing both aromatic and aliphatic components, which contribute to its chemical properties. The presence of the pyridine ring imparts basicity to the molecule, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the phenylpropyl substituent can influence the compound's hydrophobicity and lipophilicity, affecting its solubility in organic solvents. 2-(3-Phenylpropyl)pyridine may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C14H15N
InChI:InChI=1S/C14H15N/c1-2-7-13(8-3-1)9-6-11-14-10-4-5-12-15-14/h1-5,7-8,10,12H,6,9,11H2
InChI key:InChIKey=JJJPNTQYUJPWGQ-UHFFFAOYSA-N
SMILES:N=1C=CC=CC1CCCC=2C=CC=CC2
- Synonyms:
- FEMA No. 3751
- Pyridine, 2-(3-phenylpropyl)-
- alpha-(3-Phenylpropyl)pyridine
- 2-(3-Phenylpropyl)pyridine
