CymitQuimica logo

CAS 2110-25-0

:

2-pyridin-4-yl-4H-benzo[h]chromen-4-one sulfate

Description:
2-Pyridin-4-yl-4H-benzo[h]chromen-4-one sulfate, with the CAS number 2110-25-0, is a chemical compound that features a complex structure combining a chromenone moiety with a pyridine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may include good solubility in organic solvents and potential reactivity due to the presence of functional groups. The sulfate group suggests that it may have increased polarity and could participate in various chemical reactions, such as nucleophilic substitutions or hydrolysis. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The presence of the pyridine ring can also influence the compound's electronic properties, potentially affecting its interaction with biological targets. Overall, 2-pyridin-4-yl-4H-benzo[h]chromen-4-one sulfate is a structurally intriguing compound that may have applications in various fields, including drug development and materials science.
Formula:C18H13NO6S
InChI:InChI=1/C18H11NO2.H2O4S/c20-16-11-17(13-7-9-19-10-8-13)21-18-14-4-2-1-3-12(14)5-6-15(16)18;1-5(2,3)4/h1-11H;(H2,1,2,3,4)
SMILES:c1ccc2c(c1)ccc1c(=O)cc(c3ccncc3)oc21.OS(=O)(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.