CAS 211032-07-4

4-(4-bromophenyl)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole

Description:

4-(4-bromophenyl)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a bromophenyl group and a trifluoromethylphenyl group, contributing to its unique chemical properties. The presence of the bromine atom enhances its reactivity and potential for substitution reactions, while the trifluoromethyl group increases lipophilicity and can influence the compound's biological activity. The thiazole moiety is known for its role in various biological activities, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Additionally, the compound's stability and solubility characteristics can be influenced by the substituents on the aromatic rings, which may affect its interactions in biological systems. Overall, this compound exemplifies the complexity and versatility of thiazole derivatives in chemical and pharmaceutical research.

Formula: C₁₆H₉BrF₃NS

InChI: InChI=1/C16H9BrF3NS/c17-13-7-3-10(4-8-13)14-9-22-15(21-14)11-1-5-12(6-2-11)16(18,19)20/h1-9H

SMILES: c1cc(ccc1c1nc(cs1)c1ccc(cc1)Br)C(F)(F)F

4-(4-Bromophenyl)-2-(4-(trifluoromethyl)phenyl)thiazole

CAS: 211032-07-4

Formula: C₁₆H₉BrF₃NS

Molecular weight: 384.2136

Ref: IN-DA002L4V

4-(4-Bromophenyl)-2-(4-(trifluoromethyl)phenyl)thiazole

CAS: 211032-07-4

Formula: C₁₆H₉BrF₃NS

Purity: 95.0%

Molecular weight: 384.21

Ref: 10-F229861