
CAS 2110448-99-0
:20-(11,12-Didehydrodibenz[b,f]azocin-5(6H)-yl)-16,20-dioxo-4,7,10,13-tetraoxa-17-azaeicosanoic acid
Description:
The chemical substance known as "20-(11,12-Didehydrodibenz[b,f]azocin-5(6H)-yl)-16,20-dioxo-4,7,10,13-tetraoxa-17-azaeicosanoic acid" with CAS number 2110448-99-0 is a complex organic compound characterized by its unique structural features, including multiple functional groups and a polycyclic framework. This compound contains a dibenzazocin moiety, which contributes to its potential biological activity, possibly influencing interactions with biological targets. The presence of dioxo and tetraoxa groups suggests that it may exhibit significant reactivity and solubility properties, which could be relevant in medicinal chemistry. Additionally, the aza group indicates the incorporation of nitrogen into the structure, potentially affecting its pharmacokinetics and pharmacodynamics. The overall molecular architecture implies that this compound may have applications in drug development, particularly in areas requiring novel therapeutic agents. However, detailed studies on its biological activity, stability, and synthesis would be necessary to fully understand its potential uses and characteristics.
Formula:C30H36N2O8
InChI:InChI=1S/C30H36N2O8/c33-28(12-15-37-17-19-39-21-22-40-20-18-38-16-13-30(35)36)31-14-11-29(34)32-23-26-7-2-1-5-24(26)9-10-25-6-3-4-8-27(25)32/h1-8H,11-23H2,(H,31,33)(H,35,36)
InChI key:InChIKey=NSVSVWJDGZGQGL-UHFFFAOYSA-N
SMILES:C(CCNC(CCOCCOCCOCCOCCC(O)=O)=O)(=O)N1C=2C(C#CC=3C(C1)=CC=CC3)=CC=CC2
Synonyms:- 20-(11,12-Didehydrodibenz[b,f]azocin-5(6H)-yl)-16,20-dioxo-4,7,10,13-tetraoxa-17-azaeicosanoic acid
- 4,7,10,13-Tetraoxa-17-azaeicosanoic acid, 20-(11,12-didehydrodibenz[b,f]azocin-5(6H)-yl)-16,20-dioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
DBCO-PEG4-acid
CAS:DBCO-PEG4-acid is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.Formula:C30H36N2O8Color and Shape:SolidMolecular weight:552.624
