CAS 21109-25-1

(1H-Indol-2-ylmethyl)amine

Description:

(1H-Indol-2-ylmethyl)amine, with the CAS number 21109-25-1, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. This compound features an amine functional group attached to a methyl group that is further connected to the indole at the 2-position. The presence of the amine group imparts basic properties to the molecule, allowing it to participate in hydrogen bonding and potentially interact with biological systems. (1H-Indol-2-ylmethyl)amine is of interest in medicinal chemistry due to its potential pharmacological activities, including effects on neurotransmitter systems. Its structural features may contribute to its ability to cross biological membranes, making it a candidate for further research in drug development. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups, influencing its applications in various chemical and biological contexts.

Formula: C₉H₁₀N₂

InChI: InChI=1/C9H10N2/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-5,11H,6,10H2

SMILES: c1ccc2c(c1)cc(CN)[nH]2

Synonyms:

• 1-(1H-Indol-2-yl)methanamine

2-(Aminomethyl)indole, 97%

CAS: 21109-25-1

2-(Aminomethyl)indole is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference

Formula: C₉H₁₀N₂

Purity: 97%

Molecular weight: 146.19

Ref: 02-H54281

1H-​Indole-​2-​methanamine

CAS: 21109-25-1

Formula: C₉H₁₀N₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 146.1891

Ref: IN-DA002L5P

(1H-Indol-2-ylmethyl)amine

CAS: 21109-25-1

(1H-Indol-2-ylmethyl)amine

Purity: 98%

Molecular weight: 146.19g/mol

Ref: 54-OR301148

(1H-Indol-2-yl)methanamine

CAS: 21109-25-1

Formula: C₉H₁₀N₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 146.193

Ref: 10-F030469