
CAS 2112-22-3
:2,3-Dichloro-6-nitrobenzonitrile
Description:
2,3-Dichloro-6-nitrobenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two chlorine atoms, a nitro group, and a cyano group. The presence of the dichloro and nitro substituents indicates that this compound is likely to exhibit significant reactivity and polarity, influencing its solubility in various solvents. Typically, compounds like this are used in organic synthesis and may serve as intermediates in the production of pharmaceuticals or agrochemicals. The nitro group can participate in electrophilic aromatic substitution reactions, while the cyano group can act as a versatile functional group in further chemical transformations. Additionally, the compound's physical properties, such as melting point and boiling point, would be influenced by its molecular structure and the presence of electronegative substituents. Safety considerations are important, as compounds with nitro and halogen groups can pose health risks and environmental hazards, necessitating careful handling and disposal.
Formula:C7H2Cl2N2O2
InChI:InChI=1/C7H2Cl2N2O2/c8-5-1-2-6(11(12)13)4(3-10)7(5)9/h1-2H
SMILES:c1cc(c(C#N)c(c1Cl)Cl)N(=O)=O
Synonyms:- Timtec-Bb Sbb010021
- 2,3-DICHLORO-6-NITROBENZONITRILE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzonitrile, 2,3-dichloro-6-nitro-
CAS:Formula:C7H2Cl2N2O2Purity:97%Color and Shape:SolidMolecular weight:217.00902,3-Dichloro-6-nitrobenzonitrile
CAS:2,3-Dichloro-6-nitrobenzonitrilePurity:98%Molecular weight:217.01g/mol2,3-Dichloro-6-nitrobenzonitrile
CAS:<p>2,3-Dichloro-6-nitrobenzonitrile is an organic chemical compound that has a nitrile group and a nitro group. It can be synthesized by the cycloalkylation of ethyl bromoacetate with hydroxylamine. The resulting 2,3-dichloro-6-nitrobenzonitrile is extracted from the reaction mixture with water, acidified with dilute hydrochloric acid, and then precipitated as its ethyl ester salt. The 3D structure of this chemical was determined by X-ray crystallography.</p>Formula:C7H2Cl2N2O2Purity:Min. 95%Color and Shape:Yellow SolidMolecular weight:217.01 g/mol2,3-Dichloro-6-nitrobenzonitrile
CAS:Formula:C7H2Cl2N2O2Purity:97%Color and Shape:Liquid, No data available.Molecular weight:217.01




