CymitQuimica logo

CAS 2112-28-9

:

2,5-dinitrobenzamide

Description:
2,5-Dinitrobenzamide is an organic compound characterized by the presence of two nitro groups (-NO2) and an amide functional group (-C(O)NH2) attached to a benzene ring. Its molecular structure consists of a benzene ring substituted at the 2 and 5 positions with nitro groups, which significantly influence its chemical properties, including its reactivity and stability. The compound is typically a yellow crystalline solid, exhibiting moderate solubility in organic solvents. Due to the presence of nitro groups, 2,5-dinitrobenzamide is often considered a potential explosive material, necessitating careful handling and storage. It may undergo various chemical reactions, including nitration and reduction, and can serve as an intermediate in the synthesis of other chemical compounds. Additionally, its properties make it of interest in fields such as materials science and pharmaceuticals, where it may be explored for its potential applications. Safety precautions are essential when working with this compound due to its hazardous nature.
Formula:C7H5N3O5
InChI:InChI=1/C7H5N3O5/c8-7(11)5-3-4(9(12)13)1-2-6(5)10(14)15/h1-3H,(H2,8,11)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.