CymitQuimica logo

CAS 21121-54-0

:

5-chloroquinoline-8-sulfonyl chloride hydrochloride

Description:
5-Chloroquinoline-8-sulfonyl chloride hydrochloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity in various chemical reactions, particularly in the formation of sulfonamides. This compound features a quinoline ring, which contributes to its aromatic properties and potential biological activity. The presence of chlorine at the 5-position of the quinoline ring can influence its electronic properties and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and organic synthesis. The compound is often used as an intermediate in the synthesis of other chemical entities, particularly in the development of drugs due to its potential antimicrobial and antitumor activities. Safety precautions should be observed when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon hydrolysis. Proper storage and handling in a controlled environment are essential to ensure safety and stability.
Formula:C9H6Cl3NO2S
InChI:InChI=1/C9H5Cl2NO2S.ClH/c10-7-3-4-8(15(11,13)14)9-6(7)2-1-5-12-9;/h1-5H;1H
SMILES:c1cc2c(ccc(c2nc1)S(=O)(=O)Cl)Cl.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.