CAS 211235-87-9

2,3-dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarbaldehyde

Description:

2,3-Dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarbaldehyde is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a dioxine and a thieno moiety. This compound features two aldehyde functional groups, which contribute to its reactivity and potential applications in organic synthesis. The presence of the dioxine ring system imparts stability and influences the compound's electronic properties, making it of interest in various chemical reactions, including those involving nucleophiles. Its molecular structure suggests potential applications in materials science, particularly in the development of organic semiconductors or as intermediates in the synthesis of more complex molecules. Additionally, the compound may exhibit interesting biological activities, although specific studies would be necessary to elucidate its pharmacological properties. Overall, 2,3-dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarbaldehyde represents a versatile scaffold for further chemical exploration and development.

Formula: C₈H₆O₄S

InChI: InChI=1/C8H6O4S/c9-3-5-7-8(6(4-10)13-5)12-2-1-11-7/h3-4H,1-2H2

SMILES: C1COc2c(C=O)sc(C=O)c2O1

Synonyms:

• Thieno[3,4-B]-1,4-Dioxin-5,7-Dicarboxaldehyde, 2,3-Dihydro-
• 2,3-Dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarbaldehyde

Thieno[3,4-b]-1,4-dioxin-5,7-dicarboxaldehyde, 2,3-dihydro-

CAS: 211235-87-9

Formula: C₈H₆O₄S

Purity: 95%

Color and Shape: Solid

Molecular weight: 198.1958

Ref: IN-DA002L89

2,3-Dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarbaldehyde

CAS: 211235-87-9

2,3-Dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarbaldehyde

Purity: 95%

Molecular weight: 198.2g/mol

Ref: 54-OR1072559

2,3-Dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarbaldehyde

CAS: 211235-87-9

Formula: C₈H₆O₄S

Purity: 95%

Molecular weight: 198.19

Ref: 10-F431265