CAS 211238-34-5
:sodium (4R,5S,6S)-3-[(3S,5S)-5-(dimethylcarbamoyl)pyrrolidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate
Description:
The chemical substance with the name "sodium (4R,5S,6S)-3-[(3S,5S)-5-(dimethylcarbamoyl)pyrrolidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate" and CAS number 211238-34-5 is a complex organic compound characterized by its unique bicyclic structure and multiple functional groups. It contains a sodium ion, indicating it is a salt form, which typically enhances its solubility in water. The presence of a sulfanyl group suggests potential reactivity and biological activity, while the dimethylcarbamoyl moiety may contribute to its pharmacological properties. The compound's stereochemistry, indicated by the specific R and S configurations, is crucial for its biological interactions and efficacy. Additionally, the presence of a carboxylate group implies acidic properties, which can influence its behavior in biological systems. Overall, this compound is likely to be of interest in medicinal chemistry, particularly in the development of therapeutic agents.
Formula:C17H24N3NaO5S
InChI:InChI=1/C17H25N3O5S.Na/c1-7-12-11(8(2)21)16(23)20(12)13(17(24)25)14(7)26-9-5-10(18-6-9)15(22)19(3)4;/h7-12,18,21H,5-6H2,1-4H3,(H,24,25);/q;+1/p-1/t7-,8-,9+,10+,11-,12-;/m1./s1
SMILES:CC1C2C(C(C)O)C(=O)N2C(=C1SC1CC(C(=O)N(C)C)NC1)C(=O)O.[Na]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, 3-[[(3S,5S)-5-[(dimethylamino)carbonyl]-3-pyrrolidinyl]thio]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-, sodium salt (1:1), (4R,5S,6S)-
CAS:Formula:C17H24N3NaO5SColor and Shape:SolidMolecular weight:405.4443Meropenem Sodium Salt
CAS:Controlled ProductApplications Carbapenem is an antibiotic and antibacterial.
References Sunagawa, M., et al.: J. Antibiot., 43, 519 (1990), Hurst, M., et al.: Drugs, 59, 653 (2000),Formula:C17H24N3O5S·NaColor and Shape:Light YellowMolecular weight:405.44Meropenem sodium
CAS:Meropenem (SM 7338) sodium is a broad-spectrum carbapenem antibiotic that exhibits activity against both susceptible and resistant strains of Neisseria gonorrhoeae (MIC values of 0.02-0.06 mg/mL), Haemophilus influenzae (MIC values of 0.03-0.12 mg/mL), and Moraxella catarrhalis (MIC values of 0.015-0.12 mg/mL).Formula:C17H24N3NaO5SColor and Shape:SolidMolecular weight:405.44Meropenem sodium
CAS:Inhibitor of cell-wall synthesis; carbapenem class
Formula:C17H25N3O5S•NaPurity:Min. 95%Color and Shape:PowderMolecular weight:406.45 g/mol



