CAS 21124-40-3
:α-Amino-2-thiopheneacetic acid
Description:
α-Amino-2-thiopheneacetic acid, with the CAS number 21124-40-3, is an organic compound characterized by the presence of both an amino group and a thiophene ring in its structure. This compound features a thiophene moiety, which is a five-membered aromatic ring containing sulfur, contributing to its unique chemical properties. The amino group (-NH2) is attached to the alpha carbon of the acetic acid moiety, making it an α-amino acid. This structure imparts both hydrophilic and lipophilic characteristics, influencing its solubility and reactivity. α-Amino-2-thiopheneacetic acid is of interest in various fields, including medicinal chemistry, due to its potential biological activities and applications in drug development. It may exhibit properties such as antimicrobial or anti-inflammatory effects, although specific biological activities can vary based on structural modifications and the presence of substituents. Overall, this compound represents a fascinating intersection of amino acid chemistry and heterocyclic chemistry, making it a subject of interest for further research and application.
Formula:C6H7NO2S
InChI:InChI=1S/C6H7NO2S/c7-5(6(8)9)4-2-1-3-10-4/h1-3,5H,7H2,(H,8,9)
InChI key:InChIKey=XLMSKXASROPJNG-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N)C1=CC=CS1
Synonyms:- (2R)-amino(thiophen-2-yl)ethanoic acid
- (2S)-amino(thiophen-2-yl)ethanoic acid
- 2-(Thiophen-2-yl)glycine
- 2-Amino-2-(2-Thienyl)acetic acid
- 2-Amino-2-(thiophen-2-yl)acetic acid
- 2-Thiopheneacetic acid, α-amino-
- 2-Thiopheneacetic acid, α-amino-, <span class="text-smallcaps">DL</span>-
- <span class="text-smallcaps">DL</span>-2-Amino-2-thien-2-ylacetic acid
- <span class="text-smallcaps">DL</span>-2-Thienylglycine
- <span class="text-smallcaps">DL</span>-α-Amino-2-thienylacetic acid
- <span class="text-smallcaps">DL</span>-α-Amino-2-thiopheneacetic acid
- Amino(Thiophen-2-Yl)Acetic Acid
- Dl-alpha-aminothiophene-2-acetic acid
- alpha-(2-Thienyl)glycine
- α-Amino-2-thienylacetic acid
- α-Amino-2-thiopheneacetic acid
- 2-Thiopheneacetic acid, α-amino-, DL-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Thiopheneacetic acid, α-amino-
CAS:Formula:C6H7NO2SPurity:97%Color and Shape:SolidMolecular weight:157.19032-Amino-2-(2-thienyl)acetic acid
CAS:2-Amino-2-(2-thienyl)acetic acidPurity:≥95%Molecular weight:157.19g/molDL-±-Amino-2-thiopheneacetic acid
CAS:D-2-Amino-thiopheneacetic acid (DAT) is a non-selective endothelin receptor antagonist. It has an IC50 value of 2 nM for bq-123, an affinity that is mediated by receptor subtypes, and inhibits cyclic AMP production in the presence of hexapeptide. DAT was discovered as a cyclic peptide antagonist of the endothelin receptor. It binds to the same site on the endothelin receptor as endothelin itself, preventing it from binding to its receptors on cells in the body. This prevents activation of cellular responses to endothelin, such as vasoconstriction, which can lead to high blood pressure and heart disease. DAT also has been shown to have anti-inflammatory properties due to its ability to inhibit prostaglandin synthesis.Formula:C6H7NO2SPurity:Min. 95%Molecular weight:157.19 g/mol




