CAS 211245-56-6
:2-(methylsulfanyl)-4-(phenylamino)pyrimidine-5-carbaldehyde
Description:
2-(Methylsulfanyl)-4-(phenylamino)pyrimidine-5-carbaldehyde is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms. The presence of a methylsulfanyl group indicates a sulfur atom bonded to a methyl group, contributing to the compound's unique reactivity and potential biological activity. The phenylamino substituent suggests that the compound may exhibit aromatic properties, which can influence its interactions in biological systems. The aldehyde functional group at the 5-position of the pyrimidine ring is notable for its reactivity, particularly in condensation reactions and as a potential site for further functionalization. This compound may be of interest in medicinal chemistry due to its structural features, which could lead to various pharmacological activities. Its CAS number, 211245-56-6, allows for precise identification in chemical databases and literature. Overall, the combination of these functional groups and structural elements makes it a compound of interest for further research and application in various fields, including pharmaceuticals and organic synthesis.
Formula:C12H11N3OS
InChI:InChI=1/C12H11N3OS/c1-17-12-13-7-9(8-16)11(15-12)14-10-5-3-2-4-6-10/h2-8H,1H3,(H,13,14,15)
SMILES:CSc1ncc(C=O)c(=Nc2ccccc2)[nH]1
Synonyms:- 4-Anilino-2-(methylsulfanyl)pyrimidine-5-carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(Methylthio)-4-(phenylamino)pyrimidine-5-carbaldehyde
CAS:Formula:C12H11N3OSColor and Shape:SolidMolecular weight:245.30022-(Methylthio)-4-(phenylamino)pyrimidine-5-carbaldehyde
CAS:2-(Methylthio)-4-(phenylamino)pyrimidine-5-carbaldehydePurity:95%Molecular weight:245.3g/mol2-Methylsulfanyl-4-phenylamino-pyrimidine-5-carbaldehyde
CAS:<p>2-Methylsulfanyl-4-phenylamino-pyrimidine-5-carbaldehyde is a Ribonucleside, Deoxyribonucleoside, Activator, Antiviral, Synthetic and Modified DNA Nucleoside. It has been shown to inhibit viral replication in vitro by interfering with the formation of the viral diphosphate. 2-Methylsulfanyl-4-phenylamino-pyrimidine-5-carbaldehyde is a ribonucleotide that is synthesized from commercially available starting materials. This compound has shown to be active against HIV type 1 virus in vitro and has been proposed as a potential antiviral agent for the treatment of AIDS.<br>2-Methylsulfanyl-4-phenylamino pyrimidine 5 carbaldehyde (2MSAP) was found to be active against HIV type 1 virus in vitro and has been proposed as a potential antiviral agent for the treatment of</p>Formula:C12H11N3OSPurity:Min. 95%Molecular weight:245.3 g/mol




