CymitQuimica logo

CAS 211304-63-1

:

2-(piperazin-1-yl)phenol hydrochloride

Description:
2-(Piperazin-1-yl)phenol hydrochloride is a chemical compound characterized by its piperazine and phenol functional groups. It typically appears as a white to off-white crystalline powder and is soluble in water and various organic solvents, which enhances its utility in pharmaceutical applications. The compound is often studied for its potential biological activities, including its role as a pharmacological agent, particularly in the development of drugs targeting central nervous system disorders. Its hydrochloride salt form improves stability and solubility, making it more suitable for formulation in medicinal products. The presence of the piperazine moiety contributes to its ability to interact with neurotransmitter receptors, while the phenolic group may influence its antioxidant properties. Safety and handling precautions are essential, as with many chemical substances, to mitigate any potential hazards associated with its use. Overall, 2-(piperazin-1-yl)phenol hydrochloride is of interest in medicinal chemistry and pharmacology due to its structural features and biological implications.
Formula:C10H15ClN2O
InChI:InChI=1S/C10H14N2O.ClH/c13-10-4-2-1-3-9(10)12-7-5-11-6-8-12;/h1-4,11,13H,5-8H2;1H
InChI key:UQMMJMAMYMNLTE-UHFFFAOYSA-N
SMILES:C1CN(CCN1)C2=CC=CC=C2O.Cl
Found 4 products.