
CAS 21131-12-4
:4-(5,6-Dichloro-4-pyridazinyl)morpholine
Description:
4-(5,6-Dichloro-4-pyridazinyl)morpholine is a chemical compound characterized by its unique structure, which includes a morpholine ring and a pyridazine moiety with dichloro substitutions. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in pharmaceuticals or agrochemicals due to its heterocyclic nature. The presence of chlorine atoms enhances its reactivity and may influence its biological activity. Morpholine, a cyclic amine, contributes to the compound's basicity and solubility in polar solvents. The pyridazine ring adds to the compound's aromatic character, which can affect its electronic properties and interactions with biological targets. Additionally, the compound's molecular weight and specific functional groups may influence its stability, solubility, and potential toxicity. As with many heterocyclic compounds, understanding its characteristics is crucial for predicting its behavior in chemical reactions and biological systems. Safety data and handling precautions should be considered due to the presence of chlorine, which can pose health risks.
Formula:C8H9Cl2N3O
InChI:InChI=1S/C8H9Cl2N3O/c9-7-6(5-11-12-8(7)10)13-1-3-14-4-2-13/h5H,1-4H2
InChI key:InChIKey=YPQZPXGSTOPHRN-UHFFFAOYSA-N
SMILES:ClC=1C(=CN=NC1Cl)N2CCOCC2
Synonyms:- Morpholine, 4-(5,6-dichloro-4-pyridazinyl)-
- 4-(5,6-Dichloro-4-pyridazinyl)morpholine
- 3,4-Dichloro-5-(4-morpholinyl)pyridazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
