CAS 21134-38-3
:Acryloxymethyl Trimethoxysilane
Description:
Acryloxymethyl Trimethoxysilane, with the CAS number 21134-38-3, is a silane coupling agent that features both organic and inorganic components, making it valuable in various applications, particularly in the fields of adhesives, coatings, and sealants. This compound typically exhibits a clear to pale yellow liquid appearance and has a characteristic odor. It is known for its ability to enhance adhesion between organic polymers and inorganic substrates, such as glass, metals, and ceramics, due to its reactive silane groups. The presence of the acryloxy functional group allows for further polymerization, enabling it to form cross-linked networks when cured, which can improve mechanical properties and chemical resistance. Acryloxymethyl Trimethoxysilane is also soluble in organic solvents and can hydrolyze in the presence of moisture, leading to the formation of silanol groups that can further react with other materials. Safety precautions should be observed when handling this compound, as it may cause irritation to the skin and eyes.
Formula:C7H14O5Si
InChI:InChI=1S/C7H14O5Si/c1-5-7(8)12-6-13(9-2,10-3)11-4/h5H,1,6H2,2-4H3
InChI key:InChIKey=JPPHEZSCZWYTOP-UHFFFAOYSA-N
SMILES:[Si](COC(C=C)=O)(OC)(OC)OC
Synonyms:- Acrylic acid, (trimethoxysilyl)methyl ester
- 2-Propenoic acid, (trimethoxysilyl)methyl ester
- Acryloxymethyltrimethoxysilane
- Acryloyloxymethylene trimethoxysilane
- Methanol, (trimethoxysilyl)-, acrylate
- ACRYLOXYMETHYL TRIMETHOXYSILANE
- (Trimethoxysilyl)methyl acrylate
- trimethoxysilylmethyl prop-2-enoate
- Acryloyloxymethyltrimethoxysilane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(Trimethoxysilyl)methyl acrylate
CAS:(Trimethoxysilyl)methyl acrylatePurity:97%Molecular weight:206.27g/molACRYLOXYMETHYLTRIMETHOXYSILANE
CAS:<p>Acrylate Functional Trialkoxy Silane<br>Silane coupling agents have the ability to form a durable bond between organic and inorganic materials to generate desired heterogeneous environments or to incorporate the bulk properties of different phases into a uniform composite structure. The general formula has two classes of functionality. The hydrolyzable group forms stable condensation products with siliceous surfaces and other oxides such as those of aluminum, zirconium, tin, titanium, and nickel. The organofunctional group alters the wetting or adhesion characteristics of the substrate, utilizes the substrate to catalyze chemical transformations at the heterogeneous interface, orders the interfacial region, or modifies its partition characteristics, and significantly effects the covalent bond between organic and inorganic materials.<br>Acryloxymethyltrimethoxysilane<br>Coupling agent for UV curable systemsComonomer for ormosilsUsed in microparticle surface modificationComonomer for free-radical polymerizaitonInhibited with MEHQ<br></p>Formula:C7H14O5SiPurity:97%Color and Shape:Straw LiquidMolecular weight:206.27Acryloxymethyltrimethoxysilane
CAS:<p>S25019 - Acryloxymethyltrimethoxysilane</p>Formula:C7H14O5SiPurity:97%Color and Shape:Liquid, ClearMolecular weight:206.269


