CAS 211374-81-1
:4-amino-2-chlorobenzamide
Description:
4-Amino-2-chlorobenzamide is an organic compound characterized by the presence of an amino group (-NH2) and a chlorobenzamide structure. It features a benzene ring substituted with an amino group at the para position and a chloro group at the ortho position relative to the amide functional group. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the amide and amino groups, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs due to its ability to interact with biological targets. The presence of the chlorine atom may also influence its reactivity and biological activity. As with many amides, it may exhibit moderate stability under standard conditions but can be hydrolyzed under acidic or basic conditions. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H7ClN2O
InChI:InChI=1/C7H7ClN2O/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,9H2,(H2,10,11)
SMILES:c1cc(c(cc1N)Cl)C(=N)O
Synonyms:- Benzamide, 4-Amino-2-Chloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzamide, 4-amino-2-chloro-
CAS:Formula:C7H7ClN2OPurity:98%Color and Shape:SolidMolecular weight:170.59634-Amino-2-chlorobenzamide
CAS:<p>4-Amino-2-chlorobenzamide is an aminoaryl amide that can be prepared by the reaction of 4-aminobenzoic acid with chloroacetyl chloride. It is used as a reagent for the synthesis of other compounds and has been shown to have microwave and irradiation properties. The compound is soluble in water, ethanol, ether, chloroform, benzene, carbon tetrachloride, acetone, and ethyl acetate. 4-Amino-2-chlorobenzamide has been shown to react with ketones and anilides to form substituted ureas.</p>Formula:C7H7ClN2OPurity:Min. 95%Molecular weight:170.6 g/mol
