CAS 21141-35-5
:8-methoxyquinoline-2-carboxylic acid
Description:
8-Methoxyquinoline-2-carboxylic acid is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a methoxy group (-OCH3) at the 8-position and a carboxylic acid group (-COOH) at the 2-position contributes to its unique chemical properties. This compound typically appears as a solid and is soluble in organic solvents, while its carboxylic acid group can impart some solubility in polar solvents. It exhibits acidic behavior due to the carboxylic acid functionality, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, 8-methoxyquinoline-2-carboxylic acid may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features also suggest potential applications in coordination chemistry, as quinoline derivatives can act as ligands for metal ions. Overall, this compound's distinctive functional groups and structural characteristics make it a valuable substance in both synthetic and medicinal chemistry.
Formula:C11H9NO3
InChI:InChI=1/C11H9NO3/c1-15-9-4-2-3-7-5-6-8(11(13)14)12-10(7)9/h2-6H,1H3,(H,13,14)
SMILES:COc1cccc2ccc(C(=O)O)nc12
Synonyms:- 2-Quinolinecarboxylic Acid, 8-Methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Quinolinecarboxylic acid, 8-methoxy-
CAS:Formula:C11H9NO3Purity:97%Color and Shape:SolidMolecular weight:203.19418-Methoxyquinoline-2-carboxylic acid
CAS:8-Methoxyquinoline-2-carboxylic acidPurity:97%Molecular weight:203.197g/mol8-Methoxyquinoline-2-carboxylic acid
CAS:8-Methoxyquinoline-2-carboxylic acid (8MQCA) is a carboxylate that has been shown to be an effective antibacterial agent. 8MQCA can inhibit the growth of bacteria by binding to the cell wall and inhibiting the synthesis of proteins, leading to cell death. The bactericidal effect of 8MQCA against Escherichia coli and Pseudomonas aeruginosa was demonstrated using a recording technique in which the inhibition of bacterial growth was measured as a function of time. It is also used as an additive in food packaging films and paperboard to prevent photofading. 8MQCA is stable at elevated temperatures and pH levels, making it suitable for use in food packaging materials.Formula:C11H9NO3Purity:Min. 95%Molecular weight:203.19 g/mol



