CAS 21149-25-7
:7H-purin-6-amine 7-oxide
Description:
7H-purin-6-amine 7-oxide, also known as 7-aza-2,6-diaminopurine N-oxide, is a purine derivative characterized by its structural features that include a purine ring system with an amino group at the 6-position and an N-oxide functional group at the 7-position. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and methanol, which is indicative of its polar nature due to the presence of the amino and N-oxide groups. It is often studied for its potential biological activities, particularly in the context of nucleic acid metabolism and as a potential therapeutic agent. The compound's molecular structure allows it to participate in various chemical reactions, including those involving nucleophilic substitutions. Its CAS number, 21149-25-7, is a unique identifier that facilitates the easy retrieval of information regarding its properties, safety data, and applications in scientific literature and databases.
Formula:C5H5N5O
InChI:InChI=1/C5H5N5O/c6-4-3-5(8-1-7-4)9-2-10(3)11/h1-2,10H,(H2,6,7,8)
SMILES:c1nc(c2c(n1)N=CN2=O)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
