CAS 211495-85-1

dicyclopentylsilanediol

Description:

Dicyclopentylsilanediol is an organosilicon compound characterized by the presence of a silicon atom bonded to two cyclopentyl groups and two hydroxyl (–OH) groups. This structure imparts unique properties, including potential hydrophobicity due to the bulky cyclopentyl groups, which can influence its solubility and reactivity in various solvents. The hydroxyl groups contribute to its ability to form hydrogen bonds, enhancing its reactivity in condensation reactions and making it useful in applications such as silicone-based materials and coatings. Additionally, the presence of silicon in the molecular structure can provide thermal stability and resistance to degradation. Dicyclopentylsilanediol may also exhibit interesting mechanical properties, making it suitable for use in composites or as a coupling agent in polymer formulations. Its specific applications and behavior can vary based on the surrounding environment and the presence of other chemical species. As with many organosilicon compounds, safety data should be consulted to ensure proper handling and usage.

Formula: C₁₀H₂₀O₂Si

InChI: InChI=1/C10H20O2Si/c11-13(12,9-5-1-2-6-9)10-7-3-4-8-10/h9-12H,1-8H2

SMILES: C1CCC(C1)[Si](C1CCCC1)(O)O

Synonyms:

• Silanediol, 1,1-Dicyclopentyl-
• Dicyclopentylsilanediol

Silanediol, dicyclopentyl-

CAS: 211495-85-1

Formula: C₁₀H₂₀O₂Si

Purity: 95%

Color and Shape: Solid

Molecular weight: 200.3501

Ref: IN-DA0035KY

Dicyclopentylsilanediol

CAS: 211495-85-1

Dicyclopentylsilanediol

Purity: 95%

Molecular weight: 200.35g/mol

Ref: 54-OR1025770

1,1-Dicyclopentylsilanediol

CAS: 211495-85-1

Formula: C₁₀H₂₀O₂Si

Molecular weight: 200.35

Ref: 4Z-S-163001

SILANEDIOL, DICYCLOPENTYL-

CAS: 211495-85-1

Purity: 95%;RG

Molecular weight: 200.3529968

Ref: 10-F813420