CAS 21151-91-7

1-(1-benzofuran-7-yloxy)-3-[(1-methylethyl)amino]propan-2-ol

Description:

1-(1-benzofuran-7-yloxy)-3-[(1-methylethyl)amino]propan-2-ol, with the CAS number 21151-91-7, is a chemical compound that belongs to the class of beta-adrenergic agonists. This substance features a benzofuran moiety, which contributes to its aromatic properties and potential biological activity. The presence of the isopropylamino group suggests that it may interact with adrenergic receptors, influencing cardiovascular and respiratory functions. The compound is typically characterized by its solubility in organic solvents and limited solubility in water, which is common for many organic compounds with complex structures. Its molecular structure indicates potential for various pharmacological effects, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific stereochemistry, which can significantly affect its biological activity and interaction with target receptors. As with many chemical substances, safety data and handling precautions are essential for laboratory work involving this compound, given its potential biological effects.

Formula: C₁₄H₁₉NO₃

InChI: InChI=1/C14H19NO3/c1-10(2)15-8-12(16)9-18-13-5-3-4-11-6-7-17-14(11)13/h3-7,10,12,15-16H,8-9H2,1-2H3

Synonyms:

• 2-Propanol, 1-(7-benzofuranyloxy)-3-((1-methylethyl)amino)-
• BFE 55
• 1-[(Benzofuran-7-yl)oxy]-3-(isopropylamino)-2-propanol
• 1-[(Benzofuran-7-yl)oxy]-3-[(1-methylethyl)amino]-2-propanol
• 1-benzofuran-7-yloxy-3-(propan-2-ylamino)propan-2-ol

BFE-55

CAS: 21151-91-7

BFE-55 is derivative of befunolol (a beta-adrenergic partial agonist). BFE-55 interacts with only the high affinity sites in beta-adrenoceptors

Formula: C₁₄H₁₉NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 249.31

Ref: TM-T26783