CAS 21156-84-3

2-(1-methylpiperidin-4-yl)ethanol

Description:

2-(1-Methylpiperidin-4-yl)ethanol, with the CAS number 21156-84-3, is an organic compound characterized by its piperidine ring structure, which contributes to its basicity and potential for forming hydrogen bonds. This compound features a hydroxyl (-OH) group, making it an alcohol, which enhances its solubility in polar solvents like water. The presence of the 1-methylpiperidine moiety imparts unique steric and electronic properties, influencing its reactivity and interaction with biological systems. Typically, compounds of this nature may exhibit pharmacological activity, potentially acting as intermediates in the synthesis of pharmaceuticals or as ligands in coordination chemistry. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and dehydration reactions. Additionally, the compound's physical properties, such as boiling point and melting point, would be influenced by its molecular weight and functional groups. Overall, 2-(1-methylpiperidin-4-yl)ethanol is a versatile compound with applications in medicinal chemistry and organic synthesis.

Formula: C₈H₁₇NO

InChI: InChI=1/C8H17NO/c1-9-5-2-8(3-6-9)4-7-10/h8,10H,2-7H2,1H3

SMILES: CN1CCC(CC1)CCO

Synonyms:

• 2-(1-Methylpiperidin-4-Yl)Ethan-1-Ol

2-(1-Methylpiperidino)ethanol

CAS: 21156-84-3

Formula: C₈H₁₇NO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 143.2267

Ref: IN-DA006Z38

2-(1-Methylpiperidino)ethanol

CAS: 21156-84-3

2-(1-Methylpiperidino)ethanol

Formula: C₈H₁₇NO

Purity: 95%

Color and Shape: light yellow liquid

Molecular weight: 143.23g/mol

Ref: 54-OR909465

2-(1-Methylpiperidin-4-yl)ethanol

CAS: 21156-84-3

Formula: C₈H₁₇NO

Purity: 95%

Color and Shape: Liquid, Clear

Molecular weight: 143.23

Ref: 10-F067761