CymitQuimica logo

CAS 211563-40-5

:

methyl (4S)-6-chloro-4-(2-cyclopropylethynyl)-2-oxo-4-(trifluoromethyl)-3,1-benzoxazine-1-carboxylate

Description:
Methyl (4S)-6-chloro-4-(2-cyclopropylethynyl)-2-oxo-4-(trifluoromethyl)-3,1-benzoxazine-1-carboxylate is a synthetic organic compound characterized by its complex structure, which includes a benzoxazine ring, a chloro substituent, and a trifluoromethyl group. This compound is notable for its potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of the cyclopropylethynyl group may contribute to its reactivity and interaction with biological targets. The benzoxazine moiety is known for its stability and versatility in various chemical reactions, making it a valuable scaffold in drug design. Additionally, the trifluoromethyl group enhances lipophilicity and metabolic stability, which can influence the compound's bioavailability and efficacy. The compound's specific stereochemistry, indicated by the (4S) designation, may also play a crucial role in its biological activity, as stereoisomers can exhibit different pharmacological effects. Overall, this compound represents a class of molecules with potential applications in pharmaceuticals and materials science.
Formula:C16H11ClF3NO4
InChI:InChI=1/C16H11ClF3NO4/c1-24-13(22)21-12-5-4-10(17)8-11(12)15(16(18,19)20,25-14(21)23)7-6-9-2-3-9/h4-5,8-9H,2-3H2,1H3/t15-/m0/s1
SMILES:COC(=O)N1c2ccc(cc2[C@@](C#CC2CC2)(C(F)(F)F)OC1=O)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.