CAS 211567-22-5
:β-D-Glucopyranoside, dodecyl 2-(acetylamino)-2-deoxy-, 3,4,6-triacetate
Description:
β-D-Glucopyranoside, dodecyl 2-(acetylamino)-2-deoxy-, 3,4,6-triacetate, with CAS number 211567-22-5, is a glycoside derivative characterized by its complex structure that includes a dodecyl chain and multiple acetyl groups. This compound features a glucopyranoside moiety, which is a six-membered cyclic form of glucose, linked to a dodecyl group, providing hydrophobic properties that enhance its surfactant capabilities. The presence of acetyl groups at the 3, 4, and 6 positions of the glucose unit contributes to its solubility and stability in various solvents. This compound is typically used in biochemical applications, including as a surfactant or emulsifier, due to its amphiphilic nature. Its structural characteristics allow it to interact with both hydrophilic and hydrophobic environments, making it useful in formulations for pharmaceuticals, cosmetics, and food products. Additionally, the acetylation of the hydroxyl groups can influence its reactivity and biological activity, making it a subject of interest in research related to drug delivery and molecular biology.
Formula:C26H45NO9
InChI:InChI=1S/C26H45NO9/c1-6-7-8-9-10-11-12-13-14-15-16-32-26-23(27-18(2)28)25(35-21(5)31)24(34-20(4)30)22(36-26)17-33-19(3)29/h22-26H,6-17H2,1-5H3,(H,27,28)/t22-,23-,24-,25-,26-/m1/s1
InChI key:InChIKey=PIEYYMFAQMSYFF-ZFXZZAOISA-N
SMILES:O(C(C)=O)[C@H]1[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@@H](OCCCCCCCCCCCC)[C@@H]1NC(C)=O
Synonyms:- Dodecyl 2-Acetamido-3,4,6-Tri-O-Acetyl-2-Deoxy-Beta-D-Glucopyranoside
- Dodecyl 2-Acetamido-3,4,6-Tri-O-Acetyl-2-Deoxy-Ss-D-Glucopyranoside
- Dodecyl2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside
- β-<span class="text-smallcaps">D</span>-Glucopyranoside, dodecyl 2-(acetylamino)-2-deoxy-, 3,4,6-triacetate
- β-D-Glucopyranoside, dodecyl 2-(acetylamino)-2-deoxy-, 3,4,6-triacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Dodecyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside
CAS:<p>Dodecyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside is a kinetic probe that can be used to measure the activity of cellular enzymes. The production of this probe is mediated by the enzyme profile and is influenced by kinetic parameters such as the substrate concentration, rate of reaction, and the concentrations of reactants. The profile can be determined by profiling experiments in which cells are grown with varying concentrations of substrate or varying rates of reaction. Dodecyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxyb -D -glucopyranoside can be used to study microorganisms such as bacteria and photosynthetic organisms that use polypeptides for catalysis. This probe can also be recycled to yield more probes for future experiments.</p>Formula:C26H45NO9Purity:Min. 95%Molecular weight:515.64 g/mol
