CAS 21169-71-1
:Isoxazole-5-carboxylic acid
Description:
Isoxazole-5-carboxylic acid is a heterocyclic organic compound characterized by its five-membered ring structure containing both nitrogen and oxygen atoms. The isoxazole ring features a double bond between the nitrogen and adjacent carbon, contributing to its unique reactivity and properties. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical applications. Isoxazole-5-carboxylic acid is known for its role in medicinal chemistry, particularly as a building block in the synthesis of pharmaceuticals and agrochemicals. Its carboxylic acid functional group allows for further derivatization, making it versatile in organic synthesis. Additionally, the presence of the isoxazole moiety imparts biological activity, which has been explored in various research contexts. Overall, isoxazole-5-carboxylic acid is a valuable compound in both academic and industrial chemistry, with potential applications in drug development and material science.
Formula:C4H3NO3
InChI:InChI=1/C4H3NO3/c6-4(7)3-1-2-5-8-3/h1-2H,(H,6,7)
SMILES:c1cnoc1C(=O)O
Synonyms:- 1,2-Oxazole-5-Carboxylate
- 1,2-Oxazole-5-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Isoxazole-5-carboxylic acid, 98%
CAS:<p>Reaction conditions were found to allow the exclusive formation of isoxazole-5-carboxylic acid derivatives by conjugate addition, in acidic medium, of hydroxylamine to -alkoxyvinyl trichloromethyl ketone in synthesis and reactivity of isoxazoles. Isoxazole-5-carboxylic acid participates in the Synth</p>Formula:C4H2NO3Purity:98%Color and Shape:Pale cream to pale yellow to pale brown, PowderMolecular weight:112.07Isoxazole-5-carboxylic acid
CAS:Formula:C4H3NO3Purity:98%Color and Shape:SolidMolecular weight:113.0715Isoxazole-5-carboxylic acid
CAS:Isoxazole-5-carboxylic acidFormula:C4H3NO3Purity:98%Color and Shape:Colourless SolidMolecular weight:113.07g/molIsoxazole-5-carboxylic Acid
CAS:Formula:C4H3NO3Purity:>97.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:113.07Isoxazole-5-carboxylic acid
CAS:Formula:C4H3NO3Purity:98%Color and Shape:SolidMolecular weight:113.072





