CAS 21178-14-3
:2,7-Dimethyl-benzo[lmn][3,8]phenanthrolinium bis tetrafluoroborate
Description:
2,7-Dimethyl-benzo[lmn][3,8]phenanthrolinium bis(tetrafluoroborate) is a complex organic compound characterized by its unique structure, which includes a phenanthrolinium core substituted with two methyl groups at the 2 and 7 positions. This compound features a bis(tetrafluoroborate) anion, which contributes to its ionic nature and solubility in polar solvents. The presence of tetrafluoroborate ions enhances its stability and may influence its electronic properties, making it of interest in various applications, including organic electronics and photonics. The compound is typically characterized by its distinct UV-Vis absorption spectrum, which can be attributed to its conjugated system. Additionally, it may exhibit interesting electrochemical behavior due to the presence of the phenanthrolinium moiety. Safety data indicates that, like many organic salts, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 2,7-Dimethyl-benzo[lmn][3,8]phenanthrolinium bis(tetrafluoroborate) is a notable compound in the field of organic chemistry, particularly for its potential applications in advanced materials.
Formula:C16H14B2F8N2
InChI:InChI=1/C16H14N2.2BF4/c1-17-7-11-3-5-13-9-18(2)10-14-6-4-12(8-17)15(11)16(13)14;2*2-1(3,4)5/h3-10H,1-2H3;;/q+2;2*-1
Synonyms:- N,N-Dimethyl-2,7-diazapyrenium difluoroborate
- 2,7-Dimethyl-benzo[lmn][3,8]phenanthrolinium bistetrafluoroborate
- 2,7-Dimethylbenzo[Lmn][3,8]Phenanthrolinediium Ditetrafluoroborate
- 2,7-Dimethylbenzo[lmn][3,8]phenanthroline-2,7-diium tetrafluoroborate
- N,N'-dimethyl-2,7-diazapyrene bis(tetrafluoroborate)
- N,N'-dimethyl-2,7-diazapyreneditetrafluoroborate
- 2,7-Dimethyl-2,7-dihydrobenzo[lmn][3,8]phenanthrolin-2-ium hydrogen tetrafluoroborate
- N,N'-Dimethyl-2,7-Diazapyrenium bistetrafluoroborate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N,N'-Dimethyl-2,7-Diazapyrenium bistetrafluoroborate
CAS:Controlled ProductFormula:C16H14N2·2BF4Color and Shape:NeatMolecular weight:407.905N,N'-Dimethyl-2,7-Diazapyrenium bistetrafluoroborate
CAS:Please enquire for more information about N,N'-Dimethyl-2,7-Diazapyrenium bistetrafluoroborate including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C16H14B2F8N2Purity:Min. 95%Molecular weight:407.91 g/mol

