CAS 21182-09-2
:3,3′-(4-Pyridinylmethylene)bis[1H-indole]
Description:
3,3′-(4-Pyridinylmethylene)bis[1H-indole], with the CAS number 21182-09-2, is an organic compound characterized by its unique structure, which features two indole units linked by a methylene bridge to a pyridine ring. This compound exhibits properties typical of indole derivatives, including potential biological activity, such as antimicrobial or anticancer effects, due to the presence of the indole moiety, which is known for its role in various biochemical processes. The pyridine ring contributes to the compound's electron-withdrawing characteristics, influencing its reactivity and solubility in different solvents. Additionally, the presence of multiple aromatic systems may enhance its ability to engage in π-π stacking interactions, which can be significant in biological systems and material science applications. The compound's synthesis typically involves condensation reactions, and it may be of interest in medicinal chemistry for the development of new therapeutic agents. Overall, 3,3′-(4-Pyridinylmethylene)bis[1H-indole] represents a fascinating subject for research due to its structural complexity and potential applications.
Formula:C22H17N3
InChI:InChI=1S/C22H17N3/c1-3-7-20-16(5-1)18(13-24-20)22(15-9-11-23-12-10-15)19-14-25-21-8-4-2-6-17(19)21/h1-14,22,24-25H
InChI key:InChIKey=DQQBRWQAKQZTQY-UHFFFAOYSA-N
SMILES:C(C=1C=2C(NC1)=CC=CC2)(C=3C=4C(NC3)=CC=CC4)C=5C=CN=CC5
Synonyms:- 1H-Indole, 3,3′-(4-pyridinylmethylene)bis-
- 3,3′-(4-Pyridinylmethylene)bis[1H-indole]
- 3,3′-(pyridin-4-ylmethanediyl)bis(1H-indole)
- Indole, 3,3′-(4-pyridylmethylene)di-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,3'-(Pyridin-4-ylmethylene)bis(1H-indole)
CAS:Controlled ProductStability Air Sensitive
Applications 3,3'-(Pyridin-4-ylmethylene)bis(1H-indole) is a useful research chemical for organic synthesis and other chemical processes.
References Sharma, G. V. M., et al.: Tetrahedron Lett., 45, 7729 (2004); Novak, T. J., et al: J. Org. Chem., 41, 870 (1976); Gray, A. P., et al.: J. Org. Chem., 25, 1939 (1960)Formula:C22H17N3Color and Shape:Light Orange To Dark BrownMolecular weight:323.39
