CAS 21190-16-9

ethyl 4-amino-1H-imidazole-5-carboxylate

Description:

Ethyl 4-amino-1H-imidazole-5-carboxylate is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features an amino group (-NH2) and a carboxylate group (-COOEt) attached to the imidazole ring, contributing to its reactivity and potential biological activity. It is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical reactions and applications. The presence of the amino group allows for potential interactions in biological systems, making it of interest in medicinal chemistry and drug development. Additionally, the ethyl ester group can be hydrolyzed to yield the corresponding carboxylic acid, further expanding its chemical versatility. Overall, ethyl 4-amino-1H-imidazole-5-carboxylate is a compound of interest in both synthetic organic chemistry and pharmaceutical research due to its structural features and functional groups.

Formula: C₆H₉N₃O₂

InChI: InChI=1/C6H9N3O2/c1-2-11-6(10)4-5(7)9-3-8-4/h3H,2,7H2,1H3,(H,8,9)

SMILES: CCOC(=O)c1c(N)[nH]cn1

Ethyl 4-amino-5-imidazolecarboxylate

CAS: 21190-16-9

Formula: C₆H₉N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 155.1546

Ref: IN-DA00385Q

Ethyl 4-amino-1H-imidazole-5-carboxylate

CAS: 21190-16-9

Ethyl 4-amino-1H-imidazole-5-carboxylate

Purity: 97%

Molecular weight: 155.16g/mol

Ref: 54-OR1034721

ETHYL 5-AMINO-1H-IMIDAZOLE-4-CARBOXYLATE

CAS: 21190-16-9

Formula: C₆H₉N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 155.157

Ref: 10-F304743

ethyl 4-amino-1H-imidazole-5-carboxylate

CAS: 21190-16-9

Ethyl 4-amino-1H-imidazole-5-carboxylate is an ionotropic gelator, which means it is able to form gels when mixed with water. It is synthesised from aluminium chloride and primary amines. Ethyl 4-amino-1H-imidazole-5-carboxylate has been shown to have a carbonyl group and triethyl orthoformate as functional groups. The chemical structure of ethyl 4-amino-1H-imidazole-5-carboxylate is heterocyclic with three rings in the molecule. Ethyl 4 amino 1H imidazole 5 carboxylate has been used as a model substrate for biosynthesis studies of α,α'-diaminopropionic acid and its derivatives.

Formula: C₆H₉N₃O₂

Purity: Min. 95%

Molecular weight: 155.2 g/mol

Ref: 3D-WAA19016