CAS 21190-16-9
:ethyl 4-amino-1H-imidazole-5-carboxylate
Description:
Ethyl 4-amino-1H-imidazole-5-carboxylate is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features an amino group (-NH2) and a carboxylate group (-COOEt) attached to the imidazole ring, contributing to its reactivity and potential biological activity. It is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical reactions and applications. The presence of the amino group allows for potential interactions in biological systems, making it of interest in medicinal chemistry and drug development. Additionally, the ethyl ester group can be hydrolyzed to yield the corresponding carboxylic acid, further expanding its chemical versatility. Overall, ethyl 4-amino-1H-imidazole-5-carboxylate is a compound of interest in both synthetic organic chemistry and pharmaceutical research due to its structural features and functional groups.
Formula:C6H9N3O2
InChI:InChI=1/C6H9N3O2/c1-2-11-6(10)4-5(7)9-3-8-4/h3H,2,7H2,1H3,(H,8,9)
SMILES:CCOC(=O)c1c(N)[nH]cn1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl 4-amino-5-imidazolecarboxylate
CAS:Formula:C6H9N3O2Purity:97%Color and Shape:SolidMolecular weight:155.1546Ref: IN-DA00385Q
50gTo inquire100gTo inquire250mg33.00€1g65.00€5g199.00€10g279.00€15g570.00€25g575.00€Ethyl 4-amino-1H-imidazole-5-carboxylate
CAS:Ethyl 4-amino-1H-imidazole-5-carboxylatePurity:97%Molecular weight:155.16g/molETHYL 5-AMINO-1H-IMIDAZOLE-4-CARBOXYLATE
CAS:Formula:C6H9N3O2Purity:97%Color and Shape:SolidMolecular weight:155.157ethyl 4-amino-1H-imidazole-5-carboxylate
CAS:Ethyl 4-amino-1H-imidazole-5-carboxylate is an ionotropic gelator, which means it is able to form gels when mixed with water. It is synthesised from aluminium chloride and primary amines. Ethyl 4-amino-1H-imidazole-5-carboxylate has been shown to have a carbonyl group and triethyl orthoformate as functional groups. The chemical structure of ethyl 4-amino-1H-imidazole-5-carboxylate is heterocyclic with three rings in the molecule. Ethyl 4 amino 1H imidazole 5 carboxylate has been used as a model substrate for biosynthesis studies of α,α'-diaminopropionic acid and its derivatives.Formula:C6H9N3O2Purity:Min. 95%Molecular weight:155.2 g/mol



