CAS 21190-87-4
:6-bromopicolinic acid
Description:
6-Bromopicolinic acid is an organic compound that belongs to the class of pyridine carboxylic acids. It features a bromine atom substituted at the 6-position of the picolinic acid structure, which is a derivative of pyridine. This compound typically appears as a white to off-white crystalline solid and is known for its solubility in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of the bromine atom enhances its reactivity, making it useful in various chemical syntheses and applications, including medicinal chemistry and the development of pharmaceuticals. 6-Bromopicolinic acid can act as a ligand in coordination chemistry and has potential applications in the synthesis of biologically active compounds. Its molecular structure contributes to its unique properties, including its ability to form hydrogen bonds and participate in various chemical reactions. As with many chemical substances, safety precautions should be observed when handling 6-bromopicolinic acid, as it may pose health risks if ingested or inhaled.
Formula:C6H3BrNO2
InChI:InChI=1/C6H4BrNO2/c7-5-3-1-2-4(8-5)6(9)10/h1-3H,(H,9,10)/p-1
SMILES:c1cc(C(=O)[O-])nc(c1)Br
Synonyms:- 2-Bromo-6-Pyridine Carboxylic Acid
- 6-Bromo-2-Pyridine Carboxylic Acid
- 6-Bromopyridine-2-Carboxylic Acid
- 6-Bromopyridine-2-Formic Acid
- 6-Bromo-2-Pyridinecarboxylic Acid
- 2-Pyridinecarboxylic Acid, 6-Bromo-
- Rarechem Al Be 0899
- Timtec-Bb Sbb003525
- 6-Bromopyridine-2-Carboxylate
- 2-Bromo-6-pyridinecorboxylc
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
6-Bromo-2-pyridinecarboxylic Acid
CAS:Formula:C6H4BrNO2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:202.016-Bromo-2-pyridinecarboxylic acid
CAS:Formula:C6H4BrNO2Purity:97%Color and Shape:SolidMolecular weight:202.00556-Bromopyridine-2-carboxylic acid
CAS:6-Bromopyridine-2-carboxylic acidFormula:C6H4BrNO2Purity:≥95%Color and Shape: white powderMolecular weight:202.00546g/mol6-Bromopyridine-2-carboxylic acid
CAS:Formula:C6H4BrNO2Purity:97%Color and Shape:SolidMolecular weight:202.0076-Bromopicolinic acid
CAS:Controlled ProductApplications 6-Bromopicolinic acid
Formula:C6H4BrNO2Color and Shape:NeatMolecular weight:202.01





