CymitQuimica logo

CAS 21198-26-5

:

4-Trityl-3-thiosemicarbazide

Description:
4-Trityl-3-thiosemicarbazide is a chemical compound characterized by its thiosemicarbazide structure, which includes a thiosemicarbazone functional group. This compound features a trityl group, which is a bulky, hydrophobic substituent that enhances its lipophilicity and may influence its biological activity. The presence of sulfur in the thiosemicarbazide moiety contributes to its potential reactivity and interaction with various biological targets. Typically, thiosemicarbazides are known for their diverse pharmacological properties, including antimicrobial, anticancer, and anti-inflammatory activities. The compound's molecular structure allows for potential coordination with metal ions, which can be relevant in medicinal chemistry and coordination chemistry. Additionally, 4-Trityl-3-thiosemicarbazide may exhibit solubility in organic solvents, making it suitable for various synthetic applications. Its CAS number, 21198-26-5, serves as a unique identifier for regulatory and safety information. Overall, this compound's unique structural features and potential biological activities make it a subject of interest in both research and pharmaceutical development.
Formula:C20H19N3S
InChI:InChI=1/C20H19N3S/c21-23-19(24)22-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H,21H2,(H2,22,23,24)
SMILES:c1ccc(cc1)C(c1ccccc1)(c1ccccc1)N=C(NN)S
Synonyms:
  • N-tritylhydrazinecarbothioamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.