CymitQuimica logo

CAS 21203-64-5

:

6-methyl-3-nitro-pyridine-2-carboxylic acid

Description:
6-Methyl-3-nitro-pyridine-2-carboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a carboxylic acid functional group (-COOH) at the 2-position, a methyl group (-CH3) at the 6-position, and a nitro group (-NO2) at the 3-position of the pyridine ring. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The nitro group is known for its electron-withdrawing properties, which can influence the acidity and reactivity of the carboxylic acid. Additionally, the methyl group can affect the compound's steric and electronic properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its unique structure allows for various synthetic modifications, making it a valuable intermediate in organic synthesis. Safety and handling precautions should be observed due to the potential hazards associated with nitro compounds.
Formula:C7H6N2O4
InChI:InChI=1/C7H6N2O4/c1-4-2-3-5(9(12)13)6(8-4)7(10)11/h2-3H,1H3,(H,10,11)
SMILES:Cc1ccc(c(C(=O)O)n1)N(=O)=O
Synonyms:
  • 2-Pyridinecarboxylic Acid, 6-Methyl-3-Nitro-
  • 6-Methyl-3-nitropyridine-2-carboxylic acid
  • 6-Methyl-3-nitro-pyridine-2-carboxylic acid
  • 6-Methyl-3-nitropicolinic acid
  • 6-METHYL-3-NITRO-2-PYRIDINE-CARBOXYLIC ACID
  • CHEMPACIFIC 38210
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.