CymitQuimica logo

CAS 21208-62-8

:

ethyl [4-(chlorosulfonyl)phenyl]carbamate

Description:
Ethyl [4-(chlorosulfonyl)phenyl]carbamate, identified by its CAS number 21208-62-8, is a chemical compound characterized by its unique functional groups and structure. It features a carbamate moiety, which is indicative of its potential use in various chemical reactions and applications. The presence of a chlorosulfonyl group enhances its reactivity, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity can be attributed to the electrophilic nature of the chlorosulfonyl group, which can participate in nucleophilic substitution reactions. Safety considerations are important when handling this compound, as it may pose hazards due to its chlorinated and sulfonyl functionalities. Proper storage and handling protocols should be followed to mitigate any risks associated with exposure. Overall, ethyl [4-(chlorosulfonyl)phenyl]carbamate is a significant compound in synthetic organic chemistry with diverse applications.
Formula:C9H10ClNO4S
InChI:InChI=1/C9H10ClNO4S/c1-2-15-9(12)11-7-3-5-8(6-4-7)16(10,13)14/h3-6H,2H2,1H3,(H,11,12)
SMILES:CCOC(=O)Nc1ccc(cc1)S(=O)(=O)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.