CAS 2121-67-7

2,4-Dimethylpentanedioic acid

Description:

2,4-Dimethylpentanedioic acid, also known as 2,4-dimethylglutaric acid, is a dicarboxylic acid characterized by the presence of two carboxyl (-COOH) functional groups and a branched carbon chain. Its molecular structure features a five-carbon backbone with two methyl groups located at the second and fourth positions, contributing to its branched nature. This compound is typically a colorless, crystalline solid at room temperature and is soluble in water due to the polar nature of the carboxylic acid groups. It has applications in organic synthesis and can serve as an intermediate in the production of various chemicals. The presence of multiple functional groups allows for diverse reactivity, making it useful in the synthesis of polymers, pharmaceuticals, and other organic compounds. Additionally, 2,4-dimethylpentanedioic acid may exhibit properties such as acidity, which can influence its behavior in chemical reactions and interactions with other substances. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₇H₁₂O₄

InChI: InChI=1S/C7H12O4/c1-4(6(8)9)3-5(2)7(10)11/h4-5H,3H2,1-2H3,(H,8,9)(H,10,11)

InChI key: InChIKey=VIWYMIDWAOZEAZ-UHFFFAOYSA-N

SMILES: C(CC(C(O)=O)C)(C(O)=O)C

Synonyms:

• Glutaric acid, 2,4-dimethyl-
• 2,4-Dimethylpentanedioic acid
• Pentanedioic acid, 2,4-dimethyl-
• 2,4-Dimethylglutaric acid
• α,α′-Dimethylglutaric acid

2,4-Dimethylglutaric acid

CAS: 2121-67-7

Formula: C₇H₁₂O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 160.1678

Ref: IN-DA00BCE0

2,4-Dimethylpentanedioic acid

CAS: 2121-67-7

2,4-Dimethylpentanedioic acid

Purity: 98%

Ref: 54-OR1037543

2,4-Dimethylglutaric acid

CAS: 2121-67-7

Formula: C₇H₁₂O₄

Purity: 98%

Molecular weight: 160.169

Ref: 10-F099717

2,4-Dimethylpentanedioic acid

CAS: 2121-67-7

2,4-Dimethylpentanedioic acid is a low molecular weight organic compound. It has a molecular weight of 76.12 and a melting point of -114°C. This compound can be used as a model for other compounds with the same chemical formula. 2,4-Dimethylpentanedioic acid is an anion that dissolves in water and its structure can be determined by X-ray crystallography. It is also known to form dimers through intramolecular hydrogen bonding, which may cause it to fragment into smaller molecules during isolation procedures.
2,4-Dimethylpentanedioic acid is a constant that yields high yields when heated with methylamine in the presence of acetic acid and sulfuric acid. The resulting product is abyssomicin, which has been shown to have antibacterial activity against gram positive bacteria such as staphylococcus aureus and clostridium perfringens.

Formula: C₇H₁₂O₄

Purity: Min. 95%

Molecular weight: 160.17 g/mol

Ref: 3D-CAA12167