CAS 21211-09-6

3-Chlorobenzo[b]thiophene-2-carboxamide

Description:

3-Chlorobenzo[b]thiophene-2-carboxamide is an organic compound characterized by its unique structure, which includes a chlorinated benzo[b]thiophene moiety and a carboxamide functional group. This compound features a benzothiophene ring system, which contributes to its aromatic properties and potential biological activity. The presence of the chlorine atom at the 3-position of the ring can influence its reactivity and solubility, while the carboxamide group enhances its ability to form hydrogen bonds, potentially affecting its interactions with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential applications in fields such as agrochemicals or pharmaceuticals. Additionally, the compound's stability and reactivity can be influenced by environmental factors, which is important for understanding its behavior in biological systems and its potential environmental impact. Overall, 3-Chlorobenzo[b]thiophene-2-carboxamide represents a versatile chemical entity with implications in various scientific research areas.

Formula: C₉H₆ClNOS

InChI: InChI=1/C9H6ClNOS/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12/h1-4H,(H2,11,12)

SMILES: c1ccc2c(c1)c(c(C(=N)O)s2)Cl

Synonyms:

• 3-Chloro-1-Benzothiophene-2-Carboxamide
• 3-Chlorobenzothiophene-2-carboxaMide

3-chloro-1-benzothiophene-2-carboxamide

CAS: 21211-09-6

Formula: C₉H₆ClNOS

Purity: 98%

Color and Shape: Solid

Molecular weight: 211.6680

Ref: IN-DA003JAF

3-chlorobenzo[b]thiophene-2-carboxamide

CAS: 21211-09-6

3-chlorobenzo[b]thiophene-2-carboxamide

Purity: ≥95%

Molecular weight: 211.67g/mol

Ref: 54-OR21581

3-Chlorobenzo[b]thiophene-2-carboxamide

CAS: 21211-09-6

Formula: C₉H₆ClNOS

Purity: 98%

Molecular weight: 211.66

Ref: 10-F239252