CAS 212116-76-2
:C8 PEG200 Ceramide
Description:
C8 PEG200 Ceramide, identified by the CAS number 212116-76-2, is a synthetic compound that belongs to the class of ceramides, which are lipid molecules composed of sphingosine and fatty acids. This particular ceramide is characterized by its polyethylene glycol (PEG) modification, which enhances its solubility and compatibility with various formulations, particularly in cosmetic and pharmaceutical applications. The "C8" designation indicates that it contains an octanoyl (caprylic) fatty acid chain, contributing to its emollient properties. C8 PEG200 Ceramide is known for its ability to improve skin barrier function, retain moisture, and provide a smooth texture in topical products. Additionally, it exhibits biocompatibility and is often used in formulations aimed at enhancing skin hydration and overall skin health. Its mild nature makes it suitable for sensitive skin formulations, and it is commonly found in creams, lotions, and serums. Overall, C8 PEG200 Ceramide serves as an effective ingredient for promoting skin hydration and improving the stability of cosmetic products.
Formula:(C2H4O)nC31H57NO6
Synonyms:- Poly(oxy-1,2-ethanediyl), α-[4-[[(2S,3R,4E)-3-hydroxy-2-[(1-oxooctyl)amino]-4-octadecenyl]oxy]-1,4-dioxobutyl]-ω-methoxy-
- Poly(oxy-1,2-ethanediyl), α-[4-[[(2S,3R,4E)-3-hydroxy-2-[(1-oxooctyl)amino]-4-octadecen-1-yl]oxy]-1,4-dioxobutyl]-ω-methoxy-
- C8 PEG200 Ceramide
- C8 PEG 2000 ceramide
- C8 PEG ceramide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
C8 PEG-Ceramide
CAS:<p>C8 PEG-Ceramide, a lipid product, possesses the capability to synthesize lipid bilayer carriers, making it applicable for drug delivery [1] [2].</p>Formula:(C2H4O)nC31H57NO6Color and Shape:SolidMolecular weight:5000(Average)
