CAS 2121511-67-7

B-[5-Chloro-2-fluoro-4-(1-methylethoxy)phenyl]boronic acid

Description:

B-[5-Chloro-2-fluoro-4-(1-methylethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions. The compound features a phenyl ring substituted with a chlorine atom, a fluorine atom, and a 1-methylethoxy group, which contribute to its unique reactivity and solubility properties. The presence of these substituents can influence the electronic properties of the molecule, potentially enhancing its reactivity in organic synthesis. Additionally, boronic acids are often utilized in medicinal chemistry for drug development due to their ability to interact with biological targets. This compound, with its specific structural features, may exhibit interesting biological activities and could be explored for applications in pharmaceuticals or materials science. As with many boronic acids, it is important to handle this substance with care, considering its potential reactivity and the need for proper storage conditions to maintain stability.

Formula: C₉H₁₁BClFO₃

InChI: InChI=1S/C9H11BClFO3/c1-5(2)15-9-4-8(12)6(10(13)14)3-7(9)11/h3-5,13-14H,1-2H3

InChI key: InChIKey=XNFYHVCPFJIFRD-UHFFFAOYSA-N

SMILES: O(C(C)C)C1=C(Cl)C=C(B(O)O)C(F)=C1

Synonyms:

• B-[5-Chloro-2-fluoro-4-(1-methylethoxy)phenyl]boronic acid
• Boronic acid, B-[5-chloro-2-fluoro-4-(1-methylethoxy)phenyl]-

Boronic acid, B-[5-chloro-2-fluoro-4-(1-methylethoxy)phenyl]-

CAS: 2121511-67-7

Formula: C₉H₁₁BClFO₃

Purity: 97%

Molecular weight: 232.4442

Ref: IN-DA01P7HW

5-Chloro-2-fluoro-4-isopropoxyphenylboronic acid

CAS: 2121511-67-7

Purity: ≥95%

Molecular weight: 232.4400024

Ref: 10-F627536