CAS 2121511-81-5

1-[2,3-Difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone

Description:

1-[2,3-Difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone, with the CAS number 2121511-81-5, is a synthetic organic compound characterized by its complex structure that includes a phenyl ring substituted with difluoro and a boron-containing dioxaborolane moiety. This compound typically exhibits properties such as moderate solubility in organic solvents, which is common for many organofluorine compounds due to their hydrophobic nature. The presence of the dioxaborolane group suggests potential applications in organic synthesis, particularly in cross-coupling reactions or as a reagent in various chemical transformations. Additionally, the difluoro substitution may enhance its electronic properties, making it useful in materials science or medicinal chemistry. The compound's stability and reactivity can be influenced by the steric and electronic effects of the substituents, which may also affect its interactions in biological systems or its utility in catalysis. Overall, this compound represents a versatile building block in advanced organic synthesis.

Formula: C₁₄H₁₇BF₂O₃

InChI: InChI=1S/C14H17BF2O3/c1-8(18)9-6-7-10(12(17)11(9)16)15-19-13(2,3)14(4,5)20-15/h6-7H,1-5H3

InChI key: InChIKey=SBFARIKWYCEUPJ-UHFFFAOYSA-N

SMILES: FC1=C(B2OC(C)(C)C(C)(C)O2)C=CC(C(C)=O)=C1F

Synonyms:

• Ethanone, 1-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-
• 1-[2,3-Difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone

Ethanone, 1-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-

CAS: 2121511-81-5

Formula: C₁₄H₁₇BF₂O₃

Purity: 95%

Molecular weight: 282.0908

Ref: IN-DA01K9PI

4-Acetyl-2,3-difluorophenylboronic acid pinacol ester

CAS: 2121511-81-5

Purity: ≥95%

Molecular weight: 282.0899963

Ref: 10-F627629