CAS 2121512-04-5

B-(6-Chloro-1H-indazol-4-yl)boronic acid

Description:

B-(6-Chloro-1H-indazol-4-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a chlorinated indazole moiety. This compound typically exhibits a white to off-white solid appearance and is soluble in polar solvents such as water and alcohols, which is a common trait for boronic acids due to their ability to form hydrogen bonds. The presence of the boronic acid group allows for participation in various chemical reactions, including Suzuki coupling, making it valuable in organic synthesis and medicinal chemistry. The chlorinated indazole structure contributes to its potential biological activity, as indazoles are known for their diverse pharmacological properties. Additionally, the compound may exhibit moderate stability under standard laboratory conditions, but care should be taken to avoid moisture and extreme pH, which can affect its reactivity. Overall, B-(6-Chloro-1H-indazol-4-yl)boronic acid is a versatile compound with applications in drug development and material science.

Formula: C₇H₆BClN₂O₂

InChI: InChI=1S/C7H6BClN2O2/c9-4-1-6(8(12)13)5-3-10-11-7(5)2-4/h1-3,12-13H,(H,10,11)

InChI key: InChIKey=YLHIOJCHLQACKC-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C2C(=CC(Cl)=C1)NN=C2

Synonyms:

• B-(6-Chloro-1H-indazol-4-yl)boronic acid
• Boronic acid, B-(6-chloro-1H-indazol-4-yl)-

Boronic acid, B-(6-chloro-1H-indazol-4-yl)-

CAS: 2121512-04-5

Formula: C₇H₆BClN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 196.3987

Ref: IN-DA01K5C4

(6-chloro-2H-indazol-4-yl)boronic acid

CAS: 2121512-04-5

Purity: ≥95%

Molecular weight: 196.3999939

Ref: 10-F627808