CymitQuimica logo

CAS 2121512-78-3

:

B-[3-Bromo-5-[(propylamino)carbonyl]phenyl]boronic acid

Description:
B-[3-Bromo-5-[(propylamino)carbonyl]phenyl]boronic acid is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl ring that is substituted with a bromine atom and a propylamino carbonyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the bromine atom enhances its reactivity, while the propylamino carbonyl group can influence its solubility and biological activity. Boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in forming carbon-carbon bonds in organic synthesis. Additionally, the compound may exhibit specific interactions with biological targets, making it of interest in drug development. Its structural features suggest potential applications in materials science and as a building block in the synthesis of more complex molecules. As with all chemical substances, handling should be done with care, following appropriate safety protocols.
Formula:C10H13BBrNO3
InChI:InChI=1S/C10H13BBrNO3/c1-2-3-13-10(14)7-4-8(11(15)16)6-9(12)5-7/h4-6,15-16H,2-3H2,1H3,(H,13,14)
InChI key:InChIKey=NUJQDJJXOLSAOM-UHFFFAOYSA-N
SMILES:C(NCCC)(=O)C1=CC(B(O)O)=CC(Br)=C1
Synonyms:
  • Boronic acid, B-[3-bromo-5-[(propylamino)carbonyl]phenyl]-
  • B-[3-Bromo-5-[(propylamino)carbonyl]phenyl]boronic acid
Found 3 products.