CAS 2121512-80-7: B-[4,5-Dimethyl-2-(phenylmethoxy)phenyl]boronic acid
Description:B-[4,5-Dimethyl-2-(phenylmethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenylmethoxy group and two methyl substituents on a phenyl ring, contributing to its hydrophobic characteristics and potential for selective interactions in biological systems. Its boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, a vital method for forming carbon-carbon bonds in organic synthesis. Additionally, the presence of the boron atom can enhance the compound's reactivity and solubility in certain solvents. This compound may also exhibit interesting biological activities, making it a candidate for further research in drug development. As with many boronic acids, it is essential to handle this compound with care, considering its potential reactivity and the need for appropriate storage conditions to maintain stability.
Formula:C15H17BO3
InChI:InChI=1S/C15H17BO3/c1-11-8-14(16(17)18)15(9-12(11)2)19-10-13-6-4-3-5-7-13/h3-9,17-18H,10H2,1-2H3
InChI key:InChIKey=ZDNNLFRTSPULKU-UHFFFAOYSA-N
SMILES:OB(O)C=1C=C(C(=CC1OCC=2C=CC=CC2)C)C
- Synonyms:
- Boronic acid, B-[4,5-dimethyl-2-(phenylmethoxy)phenyl]-
- B-[4,5-Dimethyl-2-(phenylmethoxy)phenyl]boronic acid
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | (2-(benzyloxy)-4,5-dimethylphenyl)boronicacid REF: IN-DA01NHUMCAS: 2121512-80-7 | 97% | To inquire | Wed 26 Mar 25 |
 | 2-Benzyloxy-4,5-dimethylphenylboronic acid REF: 10-F627680CAS: 2121512-80-7 | 98% | - - - | Discontinued product |
 | (2-(Benzyloxy)-4,5-dimethylphenyl)boronic acid REF: 3D-WJD51280CAS: 2121512-80-7 | Min. 95% | - - - | Discontinued product |
(2-(benzyloxy)-4,5-dimethylphenyl)boronicacid
Ref: IN-DA01NHUM
| 250mg | To inquire | ||
| 500mg | To inquire |
2-Benzyloxy-4,5-dimethylphenylboronic acid
Ref: 10-F627680
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
(2-(Benzyloxy)-4,5-dimethylphenyl)boronic acid
Ref: 3D-WJD51280
| 1g | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
