CAS 2121513-08-2

2-[4-Methoxy-3-(1-methylethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:

2-[4-Methoxy-3-(1-methylethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique dioxaborolane structure, which features a five-membered ring containing boron and oxygen atoms. This compound typically exhibits properties such as moderate stability under ambient conditions, solubility in organic solvents, and potential reactivity due to the presence of the boron atom, which can participate in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The methoxy and isopropyl substituents on the phenyl ring contribute to its lipophilicity and may influence its electronic properties, making it useful in organic synthesis and materials science. Additionally, the compound may exhibit interesting photophysical properties, which could be leveraged in applications such as organic light-emitting diodes (OLEDs) or as intermediates in the synthesis of more complex molecules. Overall, its structural features and reactivity profile make it a valuable compound in the field of organic chemistry.

Formula: C₁₆H₂₅BO₃

InChI: InChI=1S/C16H25BO3/c1-11(2)13-10-12(8-9-14(13)18-7)17-19-15(3,4)16(5,6)20-17/h8-11H,1-7H3

InChI key: InChIKey=JMHICHZKMJMOTN-UHFFFAOYSA-N

SMILES: CC1(C)OB(OC1(C)C)C2=CC(C(C)C)=C(OC)C=C2

Synonyms:

• 2-[4-Methoxy-3-(1-methylethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
• 1,3,2-Dioxaborolane, 2-[4-methoxy-3-(1-methylethyl)phenyl]-4,4,5,5-tetramethyl-

1,3,2-Dioxaborolane, 2-[4-methoxy-3-(1-methylethyl)phenyl]-4,4,5,5-tetramethyl-

CAS: 2121513-08-2

Formula: C₁₆H₂₅BO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 276.1789

Ref: IN-DA01SDW3

4-Methoxy-3-(1-methylethyl)phenylboronic acid pinacol ester

CAS: 2121513-08-2

Purity: ≥95%

Molecular weight: 276.1799927

Ref: 10-F627579