CAS 2121513-30-0

B-(4-Chloro-1H-indazol-7-yl)boronic acid

Description:

B-(4-Chloro-1H-indazol-7-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a substituted indazole ring. This compound typically exhibits properties such as being a white to off-white solid, with good solubility in polar organic solvents like methanol and dimethyl sulfoxide. The presence of the boronic acid moiety allows for participation in various chemical reactions, including Suzuki coupling, which is valuable in organic synthesis and medicinal chemistry. The chloro substituent on the indazole ring can influence its reactivity and biological activity, making it a potential candidate for drug development. Additionally, boronic acids are known for their ability to form reversible complexes with diols, which can be exploited in sensor applications. Overall, B-(4-Chloro-1H-indazol-7-yl)boronic acid is a versatile compound with significant implications in synthetic chemistry and pharmaceutical research.

Formula: C₇H₆BClN₂O₂

InChI: InChI=1S/C7H6BClN2O2/c9-6-2-1-5(8(12)13)7-4(6)3-10-11-7/h1-3,12-13H,(H,10,11)

InChI key: InChIKey=JKWKQHLAXCIJRX-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C2C(=C(Cl)C=C1)C=NN2

Synonyms:

• Boronic acid, B-(4-chloro-1H-indazol-7-yl)-
• B-(4-Chloro-1H-indazol-7-yl)boronic acid

Boronic acid, B-(4-chloro-1H-indazol-7-yl)-

CAS: 2121513-30-0

Formula: C₇H₆BClN₂O₂

Purity: >95%

Color and Shape: Solid

Molecular weight: 196.3987

Ref: IN-DA01S3ER

(4-chloro-2H-indazol-7-yl)boronic acid

CAS: 2121513-30-0

Purity: ≥95%

Molecular weight: 196.3999939

Ref: 10-F627809