CAS 2121513-56-0

2-[2-Bromo-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:

2-[2-Bromo-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a brominated aromatic substituent. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its reactivity and interaction with biological systems. This compound is typically used in organic synthesis, particularly in cross-coupling reactions, due to the boron atom's ability to participate in nucleophilic substitution reactions. The dioxaborolane moiety is known for its stability and ability to form complexes with various substrates, making it valuable in the development of pharmaceuticals and agrochemicals. Additionally, the bromine atom serves as a good leaving group, facilitating further functionalization. Overall, this compound exhibits properties that make it a useful intermediate in synthetic chemistry, particularly in the context of creating complex organic molecules. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.

Formula: C₁₃H₁₅BBrF₃O₂

InChI: InChI=1S/C13H15BBrF3O2/c1-11(2)12(3,4)20-14(19-11)9-7-5-6-8(10(9)15)13(16,17)18/h5-7H,1-4H3

InChI key: InChIKey=IDUZBJPSTPAOJJ-UHFFFAOYSA-N

SMILES: BrC1=C(C=CC=C1C(F)(F)F)B2OC(C)(C)C(C)(C)O2

Synonyms:

• 1,3,2-Dioxaborolane, 2-[2-bromo-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-
• 2-[2-Bromo-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

1,3,2-Dioxaborolane, 2-[2-bromo-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-

CAS: 2121513-56-0

Formula: C₁₃H₁₅BBrF₃O₂

Purity: 95%

Molecular weight: 350.9672

Ref: IN-DA01RO0H

2-Bromo-3-trifluoromethylphenylboronic acid pinacol ester

CAS: 2121513-56-0

Purity: ≥95%

Molecular weight: 350.9700012

Ref: 10-F627560