CAS 2121513-73-1

B-[3-Chloro-4-methyl-2-(methylthio)phenyl]boronic acid

Description:

B-[3-Chloro-4-methyl-2-(methylthio)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a chlorinated aromatic ring, which contributes to its reactivity and potential biological activity. The methylthio group enhances its lipophilicity, potentially influencing its solubility and interaction with biological systems. Boronic acids are typically used in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in the synthesis of complex organic molecules. This compound may also exhibit properties relevant to drug development, particularly in targeting specific biological pathways. Its unique structural features, including the substitution patterns on the aromatic ring, can affect its electronic properties and reactivity, making it a subject of interest in both synthetic and medicinal chemistry research.

Formula: C₈H₁₀BClO₂S

InChI: InChI=1S/C8H10BClO2S/c1-5-3-4-6(9(11)12)8(13-2)7(5)10/h3-4,11-12H,1-2H3

InChI key: InChIKey=CDAQIJCJAQXBKW-UHFFFAOYSA-N

SMILES: S(C)C1=C(B(O)O)C=CC(C)=C1Cl

Synonyms:

• B-[3-Chloro-4-methyl-2-(methylthio)phenyl]boronic acid
• Boronic acid, B-[3-chloro-4-methyl-2-(methylthio)phenyl]-

Boronic acid, B-[3-chloro-4-methyl-2-(methylthio)phenyl]-

CAS: 2121513-73-1

Formula: C₈H₁₀BClO₂S

Purity: 95%

Molecular weight: 216.4928

Ref: IN-DA01QQF2

3-Chloro-4-methyl-2-(methylthio)phenylboronic acid

CAS: 2121513-73-1

Purity: ≥95%

Molecular weight: 216.4900055

Ref: 10-F627460