CAS 2121513-82-2

B-[2-(Hydroxymethyl)-5-(trifluoromethyl)phenyl]boronic acid

Description:

B-[2-(Hydroxymethyl)-5-(trifluoromethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a phenyl ring substituted with a hydroxymethyl group and a trifluoromethyl group, which can influence its reactivity and solubility. The trifluoromethyl group is particularly notable for imparting unique electronic properties, enhancing lipophilicity, and potentially affecting the compound's biological activity. Boronic acids are often utilized in organic synthesis, particularly in cross-coupling reactions, and can serve as important intermediates in the development of pharmaceuticals and agrochemicals. The presence of the hydroxymethyl group may also provide additional sites for further functionalization or interaction with biological targets. Overall, this compound's structure suggests potential applications in medicinal chemistry and materials science, particularly in the development of sensors or catalysts.

Formula: C₈H₈BF₃O₃

InChI: InChI=1S/C8H8BF3O3/c10-8(11,12)6-2-1-5(4-13)7(3-6)9(14)15/h1-3,13-15H,4H2

InChI key: InChIKey=CNGXBTLEDCBQAY-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(CO)C=CC(C(F)(F)F)=C1

Synonyms:

• B-[2-(Hydroxymethyl)-5-(trifluoromethyl)phenyl]boronic acid
• Boronic acid, B-[2-(hydroxymethyl)-5-(trifluoromethyl)phenyl]-

Boronic acid, B-[2-(hydroxymethyl)-5-(trifluoromethyl)phenyl]-

CAS: 2121513-82-2

Formula: C₈H₈BF₃O₃

Purity: 95%

Molecular weight: 219.9535

Ref: IN-DA01K6ZG

(2-(Hydroxymethyl)-5-(trifluoromethyl)phenyl)boronic acid

CAS: 2121513-82-2

Purity: ≥95%

Molecular weight: 219.9499969

Ref: 10-F620464