CAS 2121514-02-9

2-(2-Chloro-4,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:

2-(2-Chloro-4,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is an organoboron compound characterized by its unique dioxaborolane structure, which features a boron atom bonded to two oxygen atoms and a carbon framework. This compound contains a chloro-substituted phenyl group and two fluorine atoms, contributing to its potential reactivity and applications in organic synthesis, particularly in the field of medicinal chemistry and materials science. The presence of the tetramethyl groups enhances its stability and solubility in organic solvents. Its molecular structure suggests that it may participate in various chemical reactions, including cross-coupling reactions, which are valuable in forming carbon-carbon bonds. Additionally, the specific arrangement of substituents can influence its electronic properties, making it a candidate for further studies in drug development or as a building block in complex organic molecules. Safety and handling precautions should be observed due to the presence of halogenated groups, which can pose environmental and health risks.

Formula: C₁₂H₁₄BClF₂O₂

InChI: InChI=1S/C12H14BClF2O2/c1-11(2)12(3,4)18-13(17-11)7-5-9(15)10(16)6-8(7)14/h5-6H,1-4H3

InChI key: InChIKey=JMRMQKLNWZBIEO-UHFFFAOYSA-N

SMILES: ClC1=C(B2OC(C)(C)C(C)(C)O2)C=C(F)C(F)=C1

Synonyms:

• 2-(2-Chloro-4,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
• 1,3,2-Dioxaborolane, 2-(2-chloro-4,5-difluorophenyl)-4,4,5,5-tetramethyl-

2-(2-Chloro-4,5-difluoro-phenyl)-4,4,5,5-tetramethyl-[1,3,2]dioxaborolane

CAS: 2121514-02-9

Formula: C₁₂H₁₄BClF₂O₂

Purity: 95%

Molecular weight: 274.4992

Ref: IN-DA01FR1M

2-(2-Chloro-4,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

CAS: 2121514-02-9

Purity: ≥95%

Molecular weight: 274.5

Ref: 10-F694376