CAS 2121514-03-0

B-[3-Bromo-5-[(methoxymethylamino)carbonyl]phenyl]boronic acid

Description:

B-[3-Bromo-5-[(methoxymethylamino)carbonyl]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a bromine atom and a methoxymethylamino carbonyl group attached to a phenyl ring, contributing to its reactivity and potential biological activity. The boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, facilitating the formation of carbon-carbon bonds. Additionally, the presence of the methoxymethylamino group may enhance solubility and influence the compound's interaction with biological targets. This compound's unique structure suggests potential applications in drug development, particularly in the design of inhibitors or modulators of biological pathways. As with many boronic acids, it is important to handle this compound with care, considering its reactivity and potential environmental impact.

Formula: C₉H₁₁BBrNO₄

InChI: InChI=1S/C9H11BBrNO4/c1-12(16-2)9(13)6-3-7(10(14)15)5-8(11)4-6/h3-5,14-15H,1-2H3

InChI key: InChIKey=NCZIVIZDAGCJJB-UHFFFAOYSA-N

SMILES: C(N(OC)C)(=O)C1=CC(B(O)O)=CC(Br)=C1

Synonyms:

• B-[3-Bromo-5-[(methoxymethylamino)carbonyl]phenyl]boronic acid
• Boronic acid, B-[3-bromo-5-[(methoxymethylamino)carbonyl]phenyl]-

Boronic acid, B-[3-bromo-5-[(methoxymethylamino)carbonyl]phenyl]-

CAS: 2121514-03-0

Formula: C₉H₁₁BBrNO₄

Purity: 95%

Molecular weight: 287.9029

Ref: IN-DA01RC0U

5-Bromo-3-(N,O-dimethylhydroxylaminocarbonyl)phenylboronic acid

CAS: 2121514-03-0

Purity: ≥95%

Molecular weight: 287.8999939

Ref: 10-F627433